C16H21F3N2O — CID 120598618
4,4,4-trifluoro-N-(2-methylpiperidin-4-yl)-3-phenylbutanamide (PubChem CID 120598618) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(2-methylpiperidin-4-yl)-3-phenylbutanamide.
| Compound Name | 4,4,4-trifluoro-N-(2-methylpiperidin-4-yl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 120598618 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4,4,4-trifluoro-N-(2-methylpiperidin-4-yl)-3-phenylbutanamide |
| SMILES | CC1CC(NC(=O)CC(c2ccccc2)C(F)(F)F)CCN1 |
| InChI | InChI=1S/C16H21F3N2O/c1-11-9-13(7-8-20-11)21-15(22)10-14(16(17,18)19)12-5-3-2-4-6-12/h2-6,11,13-14,20H,7-10H2,1H3,(H,21,22) |
| InChIKey | HRXRYDMXJRYRSI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |