C22H22F3N3O — CID 86888022
N-[1-(4-cyanophenyl)piperidin-4-yl]-4,4,4-trifluoro-3-phenylbutanamide (PubChem CID 86888022) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)piperidin-4-yl]-4,4,4-trifluoro-3-phenylbutanamide.
| Compound Name | N-[1-(4-cyanophenyl)piperidin-4-yl]-4,4,4-trifluoro-3-phenylbutanamide |
|---|---|
| PubChem CID | 86888022 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[1-(4-cyanophenyl)piperidin-4-yl]-4,4,4-trifluoro-3-phenylbutanamide |
| SMILES | N#Cc1ccc(N2CCC(NC(=O)CC(c3ccccc3)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C22H22F3N3O/c23-22(24,25)20(17-4-2-1-3-5-17)14-21(29)27-18-10-12-28(13-11-18)19-8-6-16(15-26)7-9-19/h1-9,18,20H,10-14H2,(H,27,29) |
| InChIKey | JOORJYKPYFQNIC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |