C26H25N3O — CID 113081045
4-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]benzonitrile (PubChem CID 113081045) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 113081045 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-[4-(3,3-diphenylpropanoyl)piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)CC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H25N3O/c27-20-21-11-13-24(14-12-21)28-15-17-29(18-16-28)26(30)19-25(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,25H,15-19H2 |
| InChIKey | VXRXQWHMTYYUEP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |