C22H25N5O2 — CID 31475605
[(1R)-3-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-3-oxo-1-phenylpropyl]urea (PubChem CID 31475605) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is [(1R)-3-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-3-oxo-1-phenylpropyl]urea.
| Compound Name | [(1R)-3-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-3-oxo-1-phenylpropyl]urea |
|---|---|
| PubChem CID | 31475605 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [(1R)-3-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-3-oxo-1-phenylpropyl]urea |
| SMILES | N#Cc1ccc(CN2CCN(C(=O)C[C@@H](NC(N)=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N5O2/c23-15-17-6-8-18(9-7-17)16-26-10-12-27(13-11-26)21(28)14-20(25-22(24)29)19-4-2-1-3-5-19/h1-9,20H,10-14,16H2,(H3,24,25,29)/t20-/m1/s1 |
| InChIKey | HAIOCAFSFBRZFS-HXUWFJFHSA-N |
| XLogP | 2.00 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |