C25H32N4O — CID 9348711
(2R)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-[(1R)-1-phenylbutyl]propanamide (PubChem CID 9348711) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is (2R)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-[(1R)-1-phenylbutyl]propanamide.
| Compound Name | (2R)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-[(1R)-1-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 9348711 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (2R)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-[(1R)-1-phenylbutyl]propanamide |
| SMILES | CCC[C@@H](NC(=O)[C@@H](C)N1CCN(Cc2ccc(C#N)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H32N4O/c1-3-7-24(23-8-5-4-6-9-23)27-25(30)20(2)29-16-14-28(15-17-29)19-22-12-10-21(18-26)11-13-22/h4-6,8-13,20,24H,3,7,14-17,19H2,1-2H3,(H,27,30)/t20-,24-/m1/s1 |
| InChIKey | RZZVHEIVJCOSMP-HYBUGGRVSA-N |
| XLogP | 3.72 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |