C27H28N4O — CID 9398852
(2S)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide (PubChem CID 9398852) has the molecular formula C27H28N4O and a molecular weight of 424.55 g/mol. Its IUPAC name is (2S)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 9398852 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (2S)-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)[C@H](c2ccccc2)N2CCN(Cc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H28N4O/c1-21-7-13-25(14-8-21)29-27(32)26(24-5-3-2-4-6-24)31-17-15-30(16-18-31)20-23-11-9-22(19-28)10-12-23/h2-14,26H,15-18,20H2,1H3,(H,29,32)/t26-/m0/s1 |
| InChIKey | QSZFWEFCOAYFHS-SANMLTNESA-N |
| XLogP | 4.36 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |