C23H32N4O3S — CID 16597867
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide (PubChem CID 16597867) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 16597867 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-methylphenyl)-2-phenylacetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(C(=O)Nc2ccc(C)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-4-26(5-2)31(29,30)27-17-15-25(16-18-27)22(20-9-7-6-8-10-20)23(28)24-21-13-11-19(3)12-14-21/h6-14,22H,4-5,15-18H2,1-3H3,(H,24,28) |
| InChIKey | YNYYQJWGEUBTRA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |