C20H35N5O5S2 — CID 55498702
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 55498702) has the molecular formula C20H35N5O5S2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55498702 |
| Molecular Formula | C20H35N5O5S2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(C)C(=O)Nc2ccc(S(=O)(=O)NC(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H35N5O5S2/c1-6-24(7-2)32(29,30)25-14-12-23(13-15-25)17(5)20(26)21-18-8-10-19(11-9-18)31(27,28)22-16(3)4/h8-11,16-17,22H,6-7,12-15H2,1-5H3,(H,21,26) |
| InChIKey | SAEMUOZWQLLLTB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |