C18H35N5O4S — CID 55482420
N-(cyclohexylcarbamoyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]propanamide (PubChem CID 55482420) has the molecular formula C18H35N5O4S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]propanamide.
| Compound Name | N-(cyclohexylcarbamoyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55482420 |
| Molecular Formula | C18H35N5O4S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(C)C(=O)NC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H35N5O4S/c1-4-22(5-2)28(26,27)23-13-11-21(12-14-23)15(3)17(24)20-18(25)19-16-9-7-6-8-10-16/h15-16H,4-14H2,1-3H3,(H2,19,20,24,25) |
| InChIKey | KMESECHYSGLZEF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |