C15H29N5O4S — CID 46595351
N-(cyclopentylcarbamoyl)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]propanamide (PubChem CID 46595351) has the molecular formula C15H29N5O4S and a molecular weight of 375.50 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]propanamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46595351 |
| Molecular Formula | C15H29N5O4S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC(=O)NC1CCCC1)N1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C15H29N5O4S/c1-12(14(21)17-15(22)16-13-6-4-5-7-13)19-8-10-20(11-9-19)25(23,24)18(2)3/h12-13H,4-11H2,1-3H3,(H2,16,17,21,22) |
| InChIKey | YYZOEPCIPAAIGX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |