C17H29N5O5S2 — CID 16597974
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide (PubChem CID 16597974) has the molecular formula C17H29N5O5S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 16597974 |
| Molecular Formula | C17H29N5O5S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(C)C(=O)Nc2cccc(S(N)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C17H29N5O5S2/c1-4-21(5-2)29(26,27)22-11-9-20(10-12-22)14(3)17(23)19-15-7-6-8-16(13-15)28(18,24)25/h6-8,13-14H,4-5,9-12H2,1-3H3,(H,19,23)(H2,18,24,25) |
| InChIKey | JXQLHMPRKNKZGU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |