C10H13ClN2O3S — CID 55110486
3-chloro-2-methyl-N-(3-sulfamoylphenyl)propanamide (PubChem CID 55110486) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 3-chloro-2-methyl-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 55110486 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-chloro-2-methyl-N-(3-sulfamoylphenyl)propanamide |
| SMILES | CC(CCl)C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H13ClN2O3S/c1-7(6-11)10(14)13-8-3-2-4-9(5-8)17(12,15)16/h2-5,7H,6H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | TVITYSWUFNEVTK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|