C13H20N3O3S+ — CID 9274937
(2S)-2-pyrrolidin-1-ium-1-yl-N-(3-sulfamoylphenyl)propanamide (PubChem CID 9274937) has the molecular formula C13H20N3O3S+ and a molecular weight of 298.39 g/mol. Its IUPAC name is (2S)-2-pyrrolidin-1-ium-1-yl-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | (2S)-2-pyrrolidin-1-ium-1-yl-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 9274937 |
| Molecular Formula | C13H20N3O3S+ |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2S)-2-pyrrolidin-1-ium-1-yl-N-(3-sulfamoylphenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(S(N)(=O)=O)c1)[NH+]1CCCC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-10(16-7-2-3-8-16)13(17)15-11-5-4-6-12(9-11)20(14,18)19/h4-6,9-10H,2-3,7-8H2,1H3,(H,15,17)(H2,14,18,19)/p+1/t10-/m0/s1 |
| InChIKey | HVKKBXUFXVMXLU-JTQLQIEISA-O |
| XLogP | -0.66 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |