C11H17N3O3S2 — CID 104906786
(2R)-2-amino-4-methylsulfanyl-N-(3-sulfamoylphenyl)butanamide (PubChem CID 104906786) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanyl-N-(3-sulfamoylphenyl)butanamide.
| Compound Name | (2R)-2-amino-4-methylsulfanyl-N-(3-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 104906786 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanyl-N-(3-sulfamoylphenyl)butanamide |
| SMILES | CSCC[C@@H](N)C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-18-6-5-10(12)11(15)14-8-3-2-4-9(7-8)19(13,16)17/h2-4,7,10H,5-6,12H2,1H3,(H,14,15)(H2,13,16,17)/t10-/m1/s1 |
| InChIKey | OODWGWCWYWOWSE-SNVBAGLBSA-N |
| XLogP | 0.35 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |