C13H19ClN2O2S — CID 119262966
(2S)-N-(3-acetylphenyl)-2-amino-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119262966) has the molecular formula C13H19ClN2O2S and a molecular weight of 302.83 g/mol. Its IUPAC name is (2S)-N-(3-acetylphenyl)-2-amino-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2S)-N-(3-acetylphenyl)-2-amino-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119262966 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (2S)-N-(3-acetylphenyl)-2-amino-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)Nc1cccc(C(C)=O)c1.Cl |
| InChI | InChI=1S/C13H18N2O2S.ClH/c1-9(16)10-4-3-5-11(8-10)15-13(17)12(14)6-7-18-2;/h3-5,8,12H,6-7,14H2,1-2H3,(H,15,17);1H/t12-;/m0./s1 |
| InChIKey | YUYNAHQMBACZSJ-YDALLXLXSA-N |
| XLogP | 2.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |