C16H23N3O2S2 — CID 119309634
(2S)-2-amino-4-methylsulfanyl-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide (PubChem CID 119309634) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 119309634 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(thiomorpholine-4-carbonyl)phenyl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1cccc(C(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-22-8-5-14(17)15(20)18-13-4-2-3-12(11-13)16(21)19-6-9-23-10-7-19/h2-4,11,14H,5-10,17H2,1H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | PZSDIOUSXQXKOT-AWEZNQCLSA-N |
| XLogP | 1.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |