C16H25N3O3S2 — CID 119262501
(2S)-2-amino-4-methylsulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)butanamide (PubChem CID 119262501) has the molecular formula C16H25N3O3S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 119262501 |
| Molecular Formula | C16H25N3O3S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)butanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C16H25N3O3S2/c1-23-11-8-15(17)16(20)18-13-6-5-7-14(12-13)24(21,22)19-9-3-2-4-10-19/h5-7,12,15H,2-4,8-11,17H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | QZDCESFVYFJMQR-HNNXBMFYSA-N |
| XLogP | 1.88 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |