C17H26N4O4S — CID 40880076
(2S)-2-(carbamoylamino)-4-methyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)pentanamide (PubChem CID 40880076) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-4-methyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)pentanamide.
| Compound Name | (2S)-2-(carbamoylamino)-4-methyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)pentanamide |
|---|---|
| PubChem CID | 40880076 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2S)-2-(carbamoylamino)-4-methyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)pentanamide |
| SMILES | CC(C)C[C@H](NC(N)=O)C(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H26N4O4S/c1-12(2)10-15(20-17(18)23)16(22)19-13-6-5-7-14(11-13)26(24,25)21-8-3-4-9-21/h5-7,11-12,15H,3-4,8-10H2,1-2H3,(H,19,22)(H3,18,20,23)/t15-/m0/s1 |
| InChIKey | FGSRULHGHXHXJS-HNNXBMFYSA-N |
| XLogP | 1.49 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |