C20H27ClN2OS — CID 119316029
(2S)-2-amino-4-methylsulfanyl-N-[3-(3-phenylpropyl)phenyl]butanamide;hydrochloride (PubChem CID 119316029) has the molecular formula C20H27ClN2OS and a molecular weight of 378.97 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[3-(3-phenylpropyl)phenyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(3-phenylpropyl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119316029 |
| Molecular Formula | C20H27ClN2OS |
| Molecular Weight | 378.97 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(3-phenylpropyl)phenyl]butanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)Nc1cccc(CCCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C20H26N2OS.ClH/c1-24-14-13-19(21)20(23)22-18-12-6-11-17(15-18)10-5-9-16-7-3-2-4-8-16;/h2-4,6-8,11-12,15,19H,5,9-10,13-14,21H2,1H3,(H,22,23);1H/t19-;/m0./s1 |
| InChIKey | DHARYTUMBCOBPZ-FYZYNONXSA-N |
| XLogP | 4.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.97 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |