C20H26N2O2S — CID 119306583
(2S)-2-amino-4-methylsulfanyl-N-[3-(2-phenylethoxymethyl)phenyl]butanamide (PubChem CID 119306583) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[3-(2-phenylethoxymethyl)phenyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(2-phenylethoxymethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 119306583 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(2-phenylethoxymethyl)phenyl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1cccc(COCCc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N2O2S/c1-25-13-11-19(21)20(23)22-18-9-5-8-17(14-18)15-24-12-10-16-6-3-2-4-7-16/h2-9,14,19H,10-13,15,21H2,1H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | GBMWBUZEVICMQJ-IBGZPJMESA-N |
| XLogP | 3.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|