C16H27N5O5S2 — CID 43039531
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 43039531) has the molecular formula C16H27N5O5S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43039531 |
| Molecular Formula | C16H27N5O5S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)Nc2cccc(S(N)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C16H27N5O5S2/c1-3-20(4-2)28(25,26)21-10-8-19(9-11-21)13-16(22)18-14-6-5-7-15(12-14)27(17,23)24/h5-7,12H,3-4,8-11,13H2,1-2H3,(H,18,22)(H2,17,23,24) |
| InChIKey | XRYCJJHNGZUPOD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |