C20H34N4O3S — CID 16597788
N-(4-tert-butylphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide (PubChem CID 16597788) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 16597788 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)Nc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H34N4O3S/c1-6-23(7-2)28(26,27)24-14-12-22(13-15-24)16-19(25)21-18-10-8-17(9-11-18)20(3,4)5/h8-11H,6-7,12-16H2,1-5H3,(H,21,25) |
| InChIKey | QCLGEXYVIXDJIT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |