C19H31N5O5S — CID 16597958
N-(5-acetamido-2-methoxyphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide (PubChem CID 16597958) has the molecular formula C19H31N5O5S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 16597958 |
| Molecular Formula | C19H31N5O5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)Nc2cc(NC(C)=O)ccc2OC)CC1 |
| InChI | InChI=1S/C19H31N5O5S/c1-5-23(6-2)30(27,28)24-11-9-22(10-12-24)14-19(26)21-17-13-16(20-15(3)25)7-8-18(17)29-4/h7-8,13H,5-6,9-12,14H2,1-4H3,(H,20,25)(H,21,26) |
| InChIKey | OBQJXKSJRSSQGW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |