C18H31N5O3S — CID 16597798
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 16597798) has the molecular formula C18H31N5O3S and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 16597798 |
| Molecular Formula | C18H31N5O3S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)Nc2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H31N5O3S/c1-5-22(6-2)27(25,26)23-13-11-21(12-14-23)15-18(24)19-16-7-9-17(10-8-16)20(3)4/h7-10H,5-6,11-15H2,1-4H3,(H,19,24) |
| InChIKey | FGBNPDFSHNBDQJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|