C20H24Cl2N4O3S — CID 3236568
2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 3236568) has the molecular formula C20H24Cl2N4O3S and a molecular weight of 471.41 g/mol. Its IUPAC name is 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 3236568 |
| Molecular Formula | C20H24Cl2N4O3S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CN2CCN(S(=O)(=O)c3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H24Cl2N4O3S/c1-24(2)17-6-4-16(5-7-17)23-20(27)14-25-9-11-26(12-10-25)30(28,29)19-13-15(21)3-8-18(19)22/h3-8,13H,9-12,14H2,1-2H3,(H,23,27) |
| InChIKey | ASXSMJDVKZSOJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|