C18H18Cl3N3O3S — CID 2685654
2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 2685654) has the molecular formula C18H18Cl3N3O3S and a molecular weight of 462.79 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2685654 |
| Molecular Formula | C18H18Cl3N3O3S |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl3N3O3S/c19-13-1-4-15(5-2-13)28(26,27)24-9-7-23(8-10-24)12-18(25)22-14-3-6-16(20)17(21)11-14/h1-6,11H,7-10,12H2,(H,22,25) |
| InChIKey | YTWPMJSZJQFXOD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |