C18H17ClF3N3O3S — CID 5215915
2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 5215915) has the molecular formula C18H17ClF3N3O3S and a molecular weight of 447.87 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 5215915 |
| Molecular Formula | C18H17ClF3N3O3S |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H17ClF3N3O3S/c19-12-1-3-13(4-2-12)29(27,28)25-9-7-24(8-10-25)11-16(26)23-15-6-5-14(20)17(21)18(15)22/h1-6H,7-11H2,(H,23,26) |
| InChIKey | KTKHURFUGBHABG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|