C20H22F3N3O3S — CID 2088389
2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2088389) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2088389 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(CC(=O)Nc3ccc(F)c(F)c3F)CC2)c1 |
| InChI | InChI=1S/C20H22F3N3O3S/c1-13-3-4-14(2)17(11-13)30(28,29)26-9-7-25(8-10-26)12-18(27)24-16-6-5-15(21)19(22)20(16)23/h3-6,11H,7-10,12H2,1-2H3,(H,24,27) |
| InChIKey | VPVREPGZZHZBFP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|