C15H23N3O3S — CID 36849344
2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide (PubChem CID 36849344) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 36849344 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-12-4-5-13(2)14(10-12)22(20,21)18-8-6-17(7-9-18)11-15(19)16-3/h4-5,10H,6-9,11H2,1-3H3,(H,16,19) |
| InChIKey | ONFOYODHLRHIQU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |