C19H24N4O5S — CID 8694149
N'-[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]acetyl]furan-2-carbohydrazide (PubChem CID 8694149) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is N'-[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8694149 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N'-[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]acetyl]furan-2-carbohydrazide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(CC(=O)NNC(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C19H24N4O5S/c1-14-5-6-15(2)17(12-14)29(26,27)23-9-7-22(8-10-23)13-18(24)20-21-19(25)16-4-3-11-28-16/h3-6,11-12H,7-10,13H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | WDMUUVWEYWFWKV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|