C18H22N2O4S — CID 108559603
N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]furan-2-carboxamide (PubChem CID 108559603) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]furan-2-carboxamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 108559603 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(NC(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C18H22N2O4S/c1-13-5-6-14(2)17(12-13)25(22,23)20-9-7-15(8-10-20)19-18(21)16-4-3-11-24-16/h3-6,11-12,15H,7-10H2,1-2H3,(H,19,21) |
| InChIKey | JWRFTGNRIBVJIE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |