C19H23N3O3S — CID 108562425
N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]pyridine-4-carboxamide (PubChem CID 108562425) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]pyridine-4-carboxamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 108562425 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)sulfonylpiperidin-4-yl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(NC(=O)c3ccncc3)CC2)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-14-3-4-15(2)18(13-14)26(24,25)22-11-7-17(8-12-22)21-19(23)16-5-9-20-10-6-16/h3-6,9-10,13,17H,7-8,11-12H2,1-2H3,(H,21,23) |
| InChIKey | YQPZUJLGVCPANG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |