C19H19F3N2O3S — CID 27444974
3-(4-pyrrolidin-1-ylsulfonylphenyl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 27444974) has the molecular formula C19H19F3N2O3S and a molecular weight of 412.43 g/mol. Its IUPAC name is 3-(4-pyrrolidin-1-ylsulfonylphenyl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(4-pyrrolidin-1-ylsulfonylphenyl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 27444974 |
| Molecular Formula | C19H19F3N2O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3-(4-pyrrolidin-1-ylsulfonylphenyl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCC2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H19F3N2O3S/c20-15-8-9-16(19(22)18(15)21)23-17(25)10-5-13-3-6-14(7-4-13)28(26,27)24-11-1-2-12-24/h3-4,6-9H,1-2,5,10-12H2,(H,23,25) |
| InChIKey | WTQSFAWMWBBHLW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|