C21H22ClFN2O5S — CID 55442455
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate (PubChem CID 55442455) has the molecular formula C21H22ClFN2O5S and a molecular weight of 468.93 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 55442455 |
| Molecular Formula | C21H22ClFN2O5S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
| SMILES | O=C(COC(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C21H22ClFN2O5S/c22-16-6-9-18(23)19(13-16)24-20(26)14-30-21(27)10-5-15-3-7-17(8-4-15)31(28,29)25-11-1-2-12-25/h3-4,6-9,13H,1-2,5,10-12,14H2,(H,24,26) |
| InChIKey | MWVJIUPQJWHXHG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |