C23H25Cl3N2O6S — CID 3599814
[2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 3599814) has the molecular formula C23H25Cl3N2O6S and a molecular weight of 563.89 g/mol. Its IUPAC name is [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 3599814 |
| Molecular Formula | C23H25Cl3N2O6S |
| Molecular Weight | 563.89 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | O=C(COC(=O)CCCOc1ccc(Cl)cc1Cl)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C23H25Cl3N2O6S/c24-16-6-9-21(19(26)13-16)33-12-4-5-23(30)34-15-22(29)27-20-14-17(7-8-18(20)25)35(31,32)28-10-2-1-3-11-28/h6-9,13-14H,1-5,10-12,15H2,(H,27,29) |
| InChIKey | YPAMBROOUIQERW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.89 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|