C18H16Cl4N2O4S — CID 3950701
2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 3950701) has the molecular formula C18H16Cl4N2O4S and a molecular weight of 498.22 g/mol. Its IUPAC name is 2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3950701 |
| Molecular Formula | C18H16Cl4N2O4S |
| Molecular Weight | 498.22 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCCC2)cc1Cl)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl4N2O4S/c19-12-8-14(21)16(9-13(12)20)23-18(25)10-28-17-4-3-11(7-15(17)22)29(26,27)24-5-1-2-6-24/h3-4,7-9H,1-2,5-6,10H2,(H,23,25) |
| InChIKey | OPDUFHMTHLWVOB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.22 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|