C15H21ClN2O4S — CID 27161142
2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-ethylacetamide (PubChem CID 27161142) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is 2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-ethylacetamide.
| Compound Name | 2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-ethylacetamide |
|---|---|
| PubChem CID | 27161142 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-(2-chloro-4-piperidin-1-ylsulfonylphenoxy)-N-ethylacetamide |
| SMILES | CCNC(=O)COc1ccc(S(=O)(=O)N2CCCCC2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O4S/c1-2-17-15(19)11-22-14-7-6-12(10-13(14)16)23(20,21)18-8-4-3-5-9-18/h6-7,10H,2-5,8-9,11H2,1H3,(H,17,19) |
| InChIKey | HUMPSKFHZQRRLO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |