C18H27ClN2O5S — CID 126394799
2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 126394799) has the molecular formula C18H27ClN2O5S and a molecular weight of 418.94 g/mol. Its IUPAC name is 2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 126394799 |
| Molecular Formula | C18H27ClN2O5S |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(2-chloro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)COc1ccc(S(=O)(=O)N2CCCC2)cc1Cl |
| InChI | InChI=1S/C18H27ClN2O5S/c1-14(2)25-11-5-8-20-18(22)13-26-17-7-6-15(12-16(17)19)27(23,24)21-9-3-4-10-21/h6-7,12,14H,3-5,8-11,13H2,1-2H3,(H,20,22) |
| InChIKey | KGWRGWAEVDCMEP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|