C14H19ClN2O5 — CID 8587948
2-(2-chloro-4-nitrophenoxy)-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 8587948) has the molecular formula C14H19ClN2O5 and a molecular weight of 330.77 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 8587948 |
| Molecular Formula | C14H19ClN2O5 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)COc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H19ClN2O5/c1-10(2)21-7-3-6-16-14(18)9-22-13-5-4-11(17(19)20)8-12(13)15/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,16,18) |
| InChIKey | UVRFFJVGCNCHPQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|