C11H11ClN2O4 — CID 3314376
2-(2-chloro-4-nitrophenoxy)-N-prop-2-enylacetamide (PubChem CID 3314376) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-N-prop-2-enylacetamide.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 3314376 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H11ClN2O4/c1-2-5-13-11(15)7-18-10-4-3-8(14(16)17)6-9(10)12/h2-4,6H,1,5,7H2,(H,13,15) |
| InChIKey | OVJUPKNVUHDUMI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|