C14H17ClN2O6 — CID 2311184
6-[[2-(2-chloro-4-nitrophenoxy)acetyl]amino]hexanoic acid (PubChem CID 2311184) has the molecular formula C14H17ClN2O6 and a molecular weight of 344.75 g/mol. Its IUPAC name is 6-[[2-(2-chloro-4-nitrophenoxy)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(2-chloro-4-nitrophenoxy)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 2311184 |
| Molecular Formula | C14H17ClN2O6 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 6-[[2-(2-chloro-4-nitrophenoxy)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)COc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H17ClN2O6/c15-11-8-10(17(21)22)5-6-12(11)23-9-13(18)16-7-3-1-2-4-14(19)20/h5-6,8H,1-4,7,9H2,(H,16,18)(H,19,20) |
| InChIKey | XXQIOQAAIIBISI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|