C16H15Cl2N3O4 — CID 9308338
2-(2,4-dichlorophenoxy)-N-[2-(4-nitroanilino)ethyl]acetamide (PubChem CID 9308338) has the molecular formula C16H15Cl2N3O4 and a molecular weight of 384.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-(4-nitroanilino)ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-(4-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 9308338 |
| Molecular Formula | C16H15Cl2N3O4 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-(4-nitroanilino)ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15Cl2N3O4/c17-11-1-6-15(14(18)9-11)25-10-16(22)20-8-7-19-12-2-4-13(5-3-12)21(23)24/h1-6,9,19H,7-8,10H2,(H,20,22) |
| InChIKey | YKEUKRGVLIUBQA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|