C14H9Cl2FN2O4 — CID 2500769
2-(2,4-dichlorophenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 2500769) has the molecular formula C14H9Cl2FN2O4 and a molecular weight of 359.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2500769 |
| Molecular Formula | C14H9Cl2FN2O4 |
| Molecular Weight | 359.14 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9Cl2FN2O4/c15-8-1-4-13(10(16)5-8)23-7-14(20)18-9-2-3-11(17)12(6-9)19(21)22/h1-6H,7H2,(H,18,20) |
| InChIKey | BBJKHVNETQDKHC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.14 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|