C16H14ClFN2O4 — CID 9212730
2-(4-chloro-2,6-dimethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 9212730) has the molecular formula C16H14ClFN2O4 and a molecular weight of 352.75 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9212730 |
| Molecular Formula | C16H14ClFN2O4 |
| Molecular Weight | 352.75 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | Cc1cc(Cl)cc(C)c1OCC(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14ClFN2O4/c1-9-5-11(17)6-10(2)16(9)24-8-15(21)19-12-3-4-13(18)14(7-12)20(22)23/h3-7H,8H2,1-2H3,(H,19,21) |
| InChIKey | JPQSXAOOPUANQZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|