C11H11FN2O6 — CID 7776180
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methoxyacetate (PubChem CID 7776180) has the molecular formula C11H11FN2O6 and a molecular weight of 286.22 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 7776180 |
| Molecular Formula | C11H11FN2O6 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11FN2O6/c1-19-6-11(16)20-5-10(15)13-7-2-3-8(12)9(4-7)14(17)18/h2-4H,5-6H2,1H3,(H,13,15) |
| InChIKey | GLBPWZWTKBHEGW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|