C15H11FN2O8 — CID 2393523
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,4,5-trihydroxybenzoate (PubChem CID 2393523) has the molecular formula C15H11FN2O8 and a molecular weight of 366.26 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 2393523 |
| Molecular Formula | C15H11FN2O8 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(O)c(O)c(O)c1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11FN2O8/c16-9-2-1-8(5-10(9)18(24)25)17-13(21)6-26-15(23)7-3-11(19)14(22)12(20)4-7/h1-5,19-20,22H,6H2,(H,17,21) |
| InChIKey | UVPJIFMBUVZQQU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|