C15H9Br2FN2O6 — CID 23761427
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate (PubChem CID 23761427) has the molecular formula C15H9Br2FN2O6 and a molecular weight of 492.05 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 23761427 |
| Molecular Formula | C15H9Br2FN2O6 |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 489.88 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)cc(Br)c1O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9Br2FN2O6/c16-7-3-9(14(22)10(17)4-7)15(23)26-6-13(21)19-8-1-2-11(18)12(5-8)20(24)25/h1-5,22H,6H2,(H,19,21) |
| InChIKey | WXIBJQPSWDUXHW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|