C16H12Br2N2O7 — CID 23793743
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate (PubChem CID 23793743) has the molecular formula C16H12Br2N2O7 and a molecular weight of 504.09 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 23793743 |
| Molecular Formula | C16H12Br2N2O7 |
| Molecular Weight | 504.09 g/mol |
| Exact Mass | 501.90 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 3,5-dibromo-2-hydroxybenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(Br)cc(Br)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12Br2N2O7/c1-26-9-2-3-12(13(6-9)20(24)25)19-14(21)7-27-16(23)10-4-8(17)5-11(18)15(10)22/h2-6,22H,7H2,1H3,(H,19,21) |
| InChIKey | MNVFTJFNKLNAIH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.09 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|