C16H13ClN2O7 — CID 7787669
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate (PubChem CID 7787669) has the molecular formula C16H13ClN2O7 and a molecular weight of 380.74 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7787669 |
| Molecular Formula | C16H13ClN2O7 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(Cl)ccc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13ClN2O7/c1-25-10-3-4-12(13(7-10)19(23)24)18-15(21)8-26-16(22)11-6-9(17)2-5-14(11)20/h2-7,20H,8H2,1H3,(H,18,21) |
| InChIKey | BHWUZXUSSHXEHW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|