C16H16N2O6S — CID 7648323
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate (PubChem CID 7648323) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7648323 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(C)sc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N2O6S/c1-9-6-12(10(2)25-9)16(20)24-8-15(19)17-13-5-4-11(23-3)7-14(13)18(21)22/h4-7H,8H2,1-3H3,(H,17,19) |
| InChIKey | SNEXBEWPXGGWSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|